A6833912
                    pentadecafluorooctanoic acid ammonium salt , ≥98.0% , 3825-26-1
                            Synonym(s):
Ammonium pentadecafluorooctanoate;Perfluorocaprylic acid ammonium salt;Perfluorooctanoic acid ammonium salt
                            
                        
                CAS NO.:3825-26-1
Empirical Formula: C8H4F15NO2
Molecular Weight: 431.1
MDL number: MFCD00042599
EINECS: 223-320-4
| Pack Size | Price | Stock | Quantity | 
| 1G | RMB78.40 | In Stock | 
                                                 | 
                                        
| 5G | RMB278.40 | In Stock | 
                                                 | 
                                        
| 25G | RMB719.20 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 163-165(dec.) | 
                                    
| Density | 1,163 g/cm3 | 
                                    
| solubility | H2O: 0.1 g/mL, clear, colorless | 
                                    
| form | Solid | 
                                    
| BRN | 4286466 | 
                                    
| InChI | InChI=1S/C8HF15O2.H3N/c9-2(10,1(24)25)3(11,12)4(13,14)5(15,16)6(17,18)7(19,20)8(21,22)23;/h(H,24,25);1H3 | 
                                    
| InChIKey | YOALFLHFSFEMLP-UHFFFAOYSA-N | 
                                    
| SMILES | C(F)(F)(C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(=O)O.N | 
                                    
| CAS DataBase Reference | 3825-26-1(CAS DataBase Reference) | 
                                    
| EPA Substance Registry System | Ammonium perfluorooctanoate (3825-26-1) | 
                                    
Description and Uses
Polymerization of fluorinated monomers; surfactant
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS05,GHS06,GHS08  | 
                                    
| Signal word | Danger | 
| Hazard statements | H302-H318-H331-H351-H360-H362-H372 | 
| Precautionary statements | P260-P263-P280-P304+P340+P311-P305+P351+P338-P308+P313 | 
| Hazard Codes | Xn,Xi,T | 
| Risk Statements | 20/22-36/37-64-48/23-48/21/22-41-40-23-22-61 | 
| Safety Statements | 26-36-45-53 | 
| RIDADR | UN 2811 6.1/PG 3 | 
| WGK Germany | 2 | 
| RTECS | RH0782000 | 
| F | 3-10 | 
| Hazard Note | Irritant | 
| HazardClass | 6.1(a) | 
| PackingGroup | II | 
| HS Code | 29159000 | 
| Toxicity | LD50 orl-rat: 430 mg/kg AIHAAP 41,576,80 | 








