A6834012
4-Phenylcyclohexanone , ≥98% , 4894-75-1
CAS NO.:4894-75-1
Empirical Formula: C12H14O
Molecular Weight: 174.24
MDL number: MFCD00001641
EINECS: 225-517-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 10G | RMB32.00 | In Stock |
|
| 25G | RMB75.20 | In Stock |
|
| 50G | RMB143.20 | In Stock |
|
| 100G | RMB279.20 | In Stock |
|
| 250G | RMB695.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 73-77 °C (lit.) |
| Boiling point: | 158-160°C 16mm |
| Density | 0.97 g/cm3 (25℃) |
| refractive index | 1.5363 (estimate) |
| Flash point: | 100°C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform, Methanol |
| form | Crystalline Powder |
| color | White to off-white |
| Water Solubility | slightly soluble |
| BRN | 2045904 |
| InChI | InChI=1S/C12H14O/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-5,11H,6-9H2 |
| InChIKey | YKAYMASDSHFOGI-UHFFFAOYSA-N |
| SMILES | C1(=O)CCC(C2=CC=CC=C2)CC1 |
| CAS DataBase Reference | 4894-75-1(CAS DataBase Reference) |
Description and Uses
4-Phenylcyclohexanone was used in the preparation of new cardo diamine monomer, 1,1-bis[4-(4-aminophenoxy)phenyl]-4-phenylcyclohexane bearing a 4-phenylcyclohexylidene unit.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29143900 |
| Storage Class | 11 - Combustible Solids |



