PRODUCT Properties
| Boiling point: | 273.02°C (rough estimate) |
| Density | 1,11 g/cm3 |
| refractive index | 1.5060-1.5100 |
| Flash point: | 141°C |
| storage temp. | 2-8°C |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Odor | at 100.00?%. sweet floral |
| InChI | InChI=1S/C10H12O3/c1-9(11)12-7-8-13-10-5-3-2-4-6-10/h2-6H,7-8H2,1H3 |
| InChIKey | WHFKYDMBUMLWDA-UHFFFAOYSA-N |
| SMILES | C(OC(=O)C)COC1=CC=CC=C1 |
| LogP | 1.752 (est) |
| EPA Substance Registry System | Ethylene glycol monophenyl ether acetate (6192-44-5) |
Description and Uses
Phenoxyethyl acetate is not one of the more interesting of the series. It is rarely available commercially, and it does not offer any unique notes, or effects which cannot be obtained from other, readily available, low-cost perfume chemicals.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| RTECS | KM0525000 |
| HS Code | 2915.39.3500 |



