A6840612
9-Phenylanthracene , ≥98.0%(GC) , 602-55-1
CAS NO.:602-55-1
Empirical Formula: C20H14
Molecular Weight: 254.33
MDL number: MFCD00001252
EINECS: 210-019-8
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB34.40 | In Stock |
|
| 1G | RMB84.80 | In Stock |
|
| 5G | RMB288.00 | In Stock |
|
| 25G | RMB984.80 | In Stock |
|
| 100g | RMB3762.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 153-155 °C (lit.) |
| Boiling point: | 417 °C (lit.) |
| Density | 1.1180 (estimate) |
| refractive index | 1.7040 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Solid |
| color | Off-white to pale brown |
| Sensitive | Light Sensitive |
| BRN | 1910570 |
| InChI | InChI=1S/C20H14/c1-2-8-15(9-3-1)20-18-12-6-4-10-16(18)14-17-11-5-7-13-19(17)20/h1-14H |
| InChIKey | LUBXLGUQZVKOFP-UHFFFAOYSA-N |
| SMILES | C1=C2C(C=C3C(=C2C2=CC=CC=C2)C=CC=C3)=CC=C1 |
| CAS DataBase Reference | 602-55-1(CAS DataBase Reference) |
| EPA Substance Registry System | Anthracene, 9-phenyl- (602-55-1) |
Description and Uses
9-Phenylanthracene is used to synthesize organic light-emitting material intermediates.
Safety
| Symbol(GHS) | ![]() GHS09 |
| Signal word | Warning |
| Hazard statements | H410 |
| Precautionary statements | P273-P501 |
| PPE | Eyeshields, Gloves |
| Hazard Codes | N |
| Risk Statements | 50/53 |
| Safety Statements | 60-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| HazardClass | 9 |
| HS Code | 29029090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 |







