A6842412
Potassium (4-Cyanophenyl)trifluoroborate , ≥95.0% , 850623-36-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB71.20 | In Stock |
|
| 5G | RMB295.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 300°C |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| color | White to Almost white |
| InChI | 1S/C7H4BF3N.K/c9-8(10,11)7-3-1-6(5-12)2-4-7;/h1-4H;/q-1;+1 |
| InChIKey | JEQAKQWNUUSKHI-UHFFFAOYSA-N |
| SMILES | [K+].F[B-](F)(F)c1ccc(cc1)C#N |
Safety
| Symbol(GHS) |   GHS07,GHS06 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H302+H312+H332-H301-H311-H332 |
| Precautionary statements | P301+P310a-P405-P501a-P264-P270-P271-P280-P301+P312+P330-P302+P352+P312+P362+P364-P304+P340+P312-P305+P351+P338+P337+P313-P501-P261-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36/37/39-36 |
| RIDADR | 3439 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2931900090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
