A6844712
Protriptyline Hydrochloride , ≥98% , 1225-55-4
Synonym(s):
N-Methyl-5H-dibenzo[a,d]cycloheptene-5-propanamine hydrochloride
CAS NO.:1225-55-4
Empirical Formula: C19H22ClN
Molecular Weight: 299.84
MDL number: MFCD00072057
EINECS: 214-956-3
| Pack Size | Price | Stock | Quantity |
| 25mg | RMB319.20 | In Stock |
|
| 100MG | RMB743.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 169-171° |
| Flash point: | 9℃ |
| storage temp. | 2-8°C |
| solubility | H2O: soluble50mg/mL |
| pka | 8.2(at 25℃) |
| form | powder |
| color | white to off-white |
| Water Solubility | H2O: 50mg/mL |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C19H21N.ClH/c1-20-14-6-11-19-17-9-4-2-7-15(17)12-13-16-8-3-5-10-18(16)19;/h2-5,7-10,12-13,19-20H,6,11,14H2,1H3;1H |
| InChIKey | OGQDIIKRQRZXJH-UHFFFAOYSA-N |
| SMILES | C1(CCCNC)C2C=CC=CC=2C=CC2C=CC=CC1=2.Cl |
Description and Uses
Monoamine reuptake inhibitor; tricyclic antidepressant.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P310-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,T,F |
| Risk Statements | 20/21/22-36/37/38-39/23/24/25-23/24/25-11 |
| Safety Statements | 26-36-45-36/37-16-7 |
| RIDADR | 3249 |
| WGK Germany | 3 |
| RTECS | HP1400000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 2921490002 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity | dog,LDLo,oral,400mg/kg (400mg/kg),"Psychotropic Drugs and Related Compounds," 2nd ed., Usdin, E., and D.H. Efron, Washington, DC, 1972Vol. -, Pg. 88, 1972. |






