A6847412
Picolinamide , ≥98.0%(HPLC) , 1452-77-3
Synonym(s):
2-Pyridinecarboxamide;Picolinamide
CAS NO.:1452-77-3
Empirical Formula: C6H6N2O
Molecular Weight: 122.12
MDL number: MFCD00023483
EINECS: 215-921-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB60.00 | In Stock |
|
| 25G | RMB215.20 | In Stock |
|
| 100G | RMB704.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 110 °C (dec.)(lit.) |
| Boiling point: | 143 °C / 20mmHg |
| Density | 1.2236 (rough estimate) |
| refractive index | 1.5350 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | pK1: 2.10(+1) (20°C) |
| color | White to Off-White |
| BRN | 109617 |
| Cosmetics Ingredients Functions | SKIN CONDITIONING - EMOLLIENT |
| InChI | InChI=1S/C6H6N2O/c7-6(9)5-3-1-2-4-8-5/h1-4H,(H2,7,9) |
| InChIKey | IBBMAWULFFBRKK-UHFFFAOYSA-N |
| SMILES | C1(C(N)=O)=NC=CC=C1 |
| CAS DataBase Reference | 1452-77-3(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Pyridinecarboxamide (1452-77-3) |
Description and Uses
Picolinamide was used as template in preparation of molecular imprinting polymer. Picolinamide was used in a study to evaluate kinetics and mechanism of liberation of picolinamide from chromium(III)-picolinamide complexes in HClO4.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







