A6848312
2,6-Pyridinedicarbonitrile , ≥97% , 2893-33-6
CAS NO.：2893-33-6
Empirical Formula: C7H3N3
Molecular Weight: 129.12
MDL number: MFCD00129021
EINECS: 220-766-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB52.80 | In Stock |
|
| 5G | RMB79.20 | In Stock |
|
| 25g | RMB351.20 | In Stock |
|
| 100g | RMB1279.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 123-127 °C (lit.) |
| Boiling point: | 290.0±20.0 °C(Predicted) |
| Density | 1.25±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | solid |
| pka | -5.87±0.10(Predicted) |
| color | Off-white to light brown |
| InChI | InChI=1S/C7H3N3/c8-4-6-2-1-3-7(5-9)10-6/h1-3H |
| InChIKey | XNPMXMIWHVZGMJ-UHFFFAOYSA-N |
| SMILES | C1(C#N)=NC(C#N)=CC=C1 |
| CAS DataBase Reference | 2893-33-6 |
Description and Uses
2,6-Pyridinedicarbonitrile may be used to synthesize bis-tetrazoles and pyridine-based tridentate ligand 2,6-bis(α-aminoisopropyl)pyridine.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29333990 |
