PRODUCT Properties
| Melting point: | 12 °C(lit.) |
| Boiling point: | 75 °C0.3 mm Hg(lit.) |
| Density | 1.118 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,2-8°C |
| pka | 4.69±0.50(Predicted) |
| form | powder to lump to clear liquid |
| color | White or Colorless to Light yellow |
| InChI | InChI=1S/C9H9NO/c1-2-4-8(5-3-1)9-10-6-7-11-9/h1-5H,6-7H2 |
| InChIKey | ZXTHWIZHGLNEPG-UHFFFAOYSA-N |
| SMILES | O1CCN=C1C1=CC=CC=C1 |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 2934.99.4400 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







