A6855412
Pentafluorophenyl Chlorothionoformate , >95.0%(GC) , 135192-53-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB261.60 | In Stock |
|
| 5G | RMB959.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 98-102 °C/50 mmHg (lit.) |
| Density | 1.635 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 189 °F |
| form | liquid |
| InChI | InChI=1S/C7ClF5OS/c8-7(15)14-6-4(12)2(10)1(9)3(11)5(6)13 |
| InChIKey | DKFQHZNKNWNZCO-UHFFFAOYSA-N |
| SMILES | C(Cl)(=S)OC1=C(F)C(F)=C(F)C(F)=C1F |
Description and Uses
Pentafluorophenyl chlorothionoformate may be used:
- as derivatizing agent during radical-chain deoxygenations of primary alcohols
- as a reagent during the conversion of ribonucleoside to arabinonucleosides
- as reagent during the conversion of 6,8-diethyl-7-hydroxy-5-propyl-hexahydro-indolizin-3-one to O-6,8-diethyl-octahydro-3-oxo-5-propylindolizin-7-yl benzothioate
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-27-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29309090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |







