PRODUCT Properties
| Melting point: | 37-38 °C(lit.) |
| Boiling point: | 114-115 °C60 mm Hg(lit.) |
| Density | 1.4485 (estimate) |
| Flash point: | 190 °F |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 13.07±0.10(Predicted) |
| color | White |
| BRN | 2052669 |
| InChI | InChI=1S/C7H3F5O/c8-3-2(1-13)4(9)6(11)7(12)5(3)10/h13H,1H2 |
| InChIKey | PGJYYCIOYBZTPU-UHFFFAOYSA-N |
| SMILES | C1(CO)=C(F)C(F)=C(F)C(F)=C1F |
| CAS DataBase Reference | 440-60-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,3,4,5,6-Pentafluorobenzyl alcohol(440-60-8) |
Description and Uses
2,3,4,5,6-Pentafluorobenzyl alcohol was used in the synthesis of pentafluorobenzyloxy substituted metal-free phthalocyanine.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312a-P330-P501a |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 36-36/37/39-26-22-24/25 |
| WGK Germany | 3 |
| RTECS | DP0695000 |
| HazardClass | IRRITANT |
| HS Code | 29062900 |
