A6882912
1-Phenyl-1-cyclopentanecarboxylic Acid , ≥98.0% , 77-55-4
CAS NO.：77-55-4
Empirical Formula: C12H14O2
Molecular Weight: 190.24
MDL number: MFCD00001372
EINECS: 201-037-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB72.80 | In Stock |
|
| 25G | RMB271.20 | In Stock |
|
| 100G | RMB751.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 159-161 °C(lit.) |
| Boiling point: | 285.75°C (rough estimate) |
| Density | 1.0486 (rough estimate) |
| refractive index | 1.4970 (estimate) |
| storage temp. | 2-8°C |
| solubility | slightly sol. in Methanol |
| pka | 4.39±0.20(Predicted) |
| form | Powder |
| color | Cream to gray-brown |
| BRN | 1638653 |
| InChI | InChI=1S/C12H14O2/c13-11(14)12(8-4-5-9-12)10-6-2-1-3-7-10/h1-3,6-7H,4-5,8-9H2,(H,13,14) |
| InChIKey | RHPCYZLXNNRRMB-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC=C2)(C(O)=O)CCCC1 |
| CAS DataBase Reference | 77-55-4(CAS DataBase Reference) |
Description and Uses
1-Phenyl-1-cyclopentanecarboxylic acid was used to prepare precursors required for solid phase synthesis of isoxazole and isoxazoline derivatives.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H335-H319 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| Hazard Codes | Xi,C |
| Risk Statements | 36/37/38-34 |
| Safety Statements | 37/39-26-45-36/37/39-27 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
