A6885912
4-(2-Pyridyl)benzaldehyde , >95.0% , 127406-56-8
CAS NO.:127406-56-8
Empirical Formula: C12H9NO
Molecular Weight: 183.21
MDL number: MFCD01863537
EINECS: 627-948-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB60.00 | In Stock |
|
| 25g | RMB239.20 | In Stock |
|
| 100g | RMB799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 50-52 °C(lit.) |
| Boiling point: | 340.4±25.0 °C(Predicted) |
| Density | 1.147±0.06 g/cm3(Predicted) |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Soluble in Chloroform |
| pka | 3.97±0.25(Predicted) |
| form | Solid |
| color | White to Off-White Waxy |
| InChI | 1S/C12H9NO/c14-9-10-4-6-11(7-5-10)12-3-1-2-8-13-12/h1-9H |
| InChIKey | NMLYGLCBSFKJFI-UHFFFAOYSA-N |
| SMILES | [H]C(=O)c1ccc(cc1)-c2ccccn2 |
| CAS DataBase Reference | 127406-56-8(CAS DataBase Reference) |
Description and Uses
Reactive metabolite of atazanavir. Atazanavir Impurity; Pyridinyl Benzaldehyde impurity
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36/37-36/37/39-22 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





