A6895912
4-Phenylbenzoyl Chloride , >98.0%(GC) , 14002-51-8
Synonym(s):
4-Phenylbenzoyl chloride
CAS NO.:14002-51-8
Empirical Formula: C13H9ClO
Molecular Weight: 216.66
MDL number: MFCD00000692
EINECS: 237-804-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB48.80 | In Stock |
|
| 5G | RMB181.60 | In Stock |
|
| 25G | RMB639.20 | In Stock |
|
| 100G | RMB1999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 110-112 °C (lit.) |
| Boiling point: | 160 °C / 2mmHg |
| Density | 1.1459 (rough estimate) |
| refractive index | 1.5260 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Fine Crystalline Powder |
| color | White to yellow |
| Water Solubility | HYDROLYSIS |
| Sensitive | Moisture Sensitive/Lachrymatory |
| BRN | 472842 |
| InChI | 1S/C13H9ClO/c14-13(15)12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9H |
| InChIKey | JPVUWCPKMYXOKW-UHFFFAOYSA-N |
| SMILES | ClC(=O)c1ccc(cc1)-c2ccccc2 |
| CAS DataBase Reference | 14002-51-8(CAS DataBase Reference) |
| EPA Substance Registry System | [1,1'-Biphenyl]-4-carbonyl chloride (14002-51-8) |
Description and Uses
Biphenyl-4-carbonyl chloride was used in the preparation of a novel thiourea compound, N-(6-methyl pyridin-2-yl-carbamothioyl)biphenyl-4-carboxamide. It was also used in the preparation of 5-CF3-oxazole analog, 2-{4-[2-(2-biphenyl-4-yl-5-trifluoromethyl-oxazol-4-yl)-ethoxy]-phenoxy}-2-methyl-propionic acid.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| Hazard Codes | C |
| Risk Statements | 14-34 |
| Safety Statements | 26-36/37/39-43-45-25 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| F | 21-10 |
| Hazard Note | Corrosive/Lachrymatory/Moisture Sensitive |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29163990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |





