A6898112
2,2,3,3,3-Pentafluoropropyl Methacrylate (stabilized with TBC) , >98.0%(GC) , 45115-53-5
Synonym(s):
1,1-Dihydroperfluoropropyl methacrylate;1H ,1H -Pentafluoropropyl methacrylate;2,2,3,3,3-Pentafluoropropyl methacrylate
CAS NO.：45115-53-5
Empirical Formula: C7H7F5O2
Molecular Weight: 218.12
MDL number: MFCD00039256
EINECS: 256-191-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB59.20 | In Stock |
|
| 25G | RMB1032.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 55 °C100 mm Hg(lit.) |
| Density | 1.277 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 85 °F |
| storage temp. | 2-8°C |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 1.573 |
| InChI | InChI=1S/C7H7F5O2/c1-4(2)5(13)14-3-6(8,9)7(10,11)12/h1,3H2,2H3 |
| InChIKey | CLISWDZSTWQFNX-UHFFFAOYSA-N |
| SMILES | C(OCC(F)(F)C(F)(F)F)(=O)C(C)=C |
| CAS DataBase Reference | 45115-53-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 1h,1h-Pentafluoropropyl methacrylate(45115-53-5) |
| EPA Substance Registry System | 2,2,3,3,3-Pentafluoropropyl methacrylate (45115-53-5) |
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,F |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 16-26-36 |
| RIDADR | UN 3272 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant/Keep Cold |
| TSCA | T |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29161400 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
