A6901612
Pinacyanol Chloride , 2768-90-3
Synonym(s):
1,1′-Diethyl-2,2′-carbocyanine chloride;2,2′-Trimethinequinocyanine chloride;Quinaldine blue
CAS NO.:2768-90-3
Empirical Formula: C25H25ClN2
Molecular Weight: 388.93
MDL number: MFCD00011974
EINECS: 220-457-1
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB183.20 | In Stock |
|
| 250mg | RMB239.20 | In Stock |
|
| 1G | RMB623.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 270 °C (dec.)(lit.) |
| Boiling point: | 543.58°C (rough estimate) |
| Density | 1.0453 (rough estimate) |
| refractive index | 1.5940 (estimate) |
| storage temp. | 2-8°C |
| form | powder to crystal |
| color | Green to Dark green |
| λmax | 560 nm (2nd) 604 nm |
| ε(extinction coefficient) | ≥150000 at 603-609nm in ethanol at 0.001g/L ≥65000 at 559-565nm in ethanol at 0.001g/L |
| Merck | 14,8048 |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C25H25N2.ClH/c1-3-26-22(18-16-20-10-5-7-14-24(20)26)12-9-13-23-19-17-21-11-6-8-15-25(21)27(23)4-2;/h5-19H,3-4H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | FVMNARAKYNRZID-UHFFFAOYSA-M |
| SMILES | [Cl-].CCN1C(=C\C=C\c2ccc3ccccc3[n+]2CC)\C=Cc4ccccc14 |
| CAS DataBase Reference | 2768-90-3(CAS DataBase Reference) |
| EPA Substance Registry System | Quinolinium, 1-ethyl-2-[3-(1-ethyl-2(1H)-quinolinylidene)-1-propenyl]-, chloride (2768-90-3) |
Description and Uses
Pinacyanol chloride is a water-soluble dichroic dye.
Histological stain (chromosomes).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 2933.49.7000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







