A6916112
Phenyl 1,4-Dihydroxy-2-naphthoate , >98.0%(HPLC) , 54978-55-1
CAS NO.：54978-55-1
Empirical Formula: C17H12O4
Molecular Weight: 280.27
MDL number: MFCD00075770
EINECS: 259-419-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB199.20 | In Stock |
|
| 25G | RMB712.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 156°C |
| Boiling point: | 505.4±35.0 °C(Predicted) |
| Density | 1.375±0.06 g/cm3(Predicted) |
| pka | 8.39±0.50(Predicted) |
| form | powder to crystal |
| color | Light yellow to Yellow to Green |
| InChI | InChI=1S/C17H12O4/c18-15-10-14(16(19)13-9-5-4-8-12(13)15)17(20)21-11-6-2-1-3-7-11/h1-10,18-19H |
| InChIKey | XDUXGEPGVNWEBQ-UHFFFAOYSA-N |
| SMILES | C1(O)=C2C(C=CC=C2)=C(O)C=C1C(OC1=CC=CC=C1)=O |
| CAS DataBase Reference | 54978-55-1(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Naphthalenecarboxylic acid, 1,4-dihydroxy-, phenyl ester (54978-55-1) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P233-P260-P261-P264-P271-P280-P302+P352-P304-P304+P340-P305+P351+P338-P312-P321-P332+P313-P337+P313-P340-P362-P403-P403+P233-P405-P501 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| HS Code | 2918.29.7500 |
