A6916212
Phthalocyanine Chloroaluminum , >98.0% , 14154-42-8
Synonym(s):
Chloro(29H,31H-phthalocyaninato)aluminum
CAS NO.:14154-42-8
Empirical Formula: C32H16AlClN8
Molecular Weight: 574.97
MDL number: MFCD00049386
EINECS: 237-998-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB359.20 | In Stock |
|
| 5g | RMB1199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| color | Very Dark Blue |
| λmax | 680 nm |
| Stability: | Light Sensitive |
| InChIKey | LBGCRGLFTKVXDZ-UHFFFAOYSA-M |
| SMILES | Cl[Al]1n2c3nc4nc(nc5n1c(nc6nc(nc2c7ccccc37)c8ccccc68)c9ccccc59)c%10ccccc4%10 |
| EPA Substance Registry System | Aluminum, chloro[29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-5-12)- (14154-42-8) |
Description and Uses
Aluminum phthalocyanine chloride (CAS# 14154-42-8) is a fluorescent organometallic compound, able to generate reactive oxygen species. The photophysical properties of aluminum phthalocyanine chloride has allowed for the preparation of thin film organic photodetectors for indirect X-ray detection.
Safety
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22 |
| Safety Statements | 22-24/25-36/37 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |




