A6923412
Phytantriol (mixture of isomers) , >95.0%(GC) , 74563-64-7
CAS NO.：74563-64-7
Empirical Formula: C20H42O3
Molecular Weight: 330.55
MDL number: MFCD00129085
EINECS: 277-923-2
| Pack Size | Price | Stock | Quantity |
| 200mg | RMB172.00 | In Stock |
|
| 1G | RMB559.20 | In Stock |
|
| 5G | RMB1519.20 | In Stock |
|
| 25G | RMB3839.20 | In Stock |
|
| 100G | RMB7199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 5–10 °C (41–50 °F; 278–283 K) |
| Boiling point: | 145 °C (1.45 ×10−5 psi); 300 °C (14.69 psi) |
| Density | 0.905 g/ml |
| vapor pressure | 0Pa at 25℃ |
| refractive index | 1.47 |
| Flash point: | 199 °C |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly) |
| pka | 14.40±0.29(Predicted) |
| form | clear viscous liquid |
| color | Pale yellow |
| Water Solubility | 352μg/L at 20℃ |
| Merck | 14,7386 |
| Cosmetics Ingredients Functions | HUMECTANT |
| InChI | InChI=1S/C20H42O3/c1-16(2)9-6-10-17(3)11-7-12-18(4)13-8-14-20(5,23)19(22)15-21/h16-19,21-23H,6-15H2,1-5H3 |
| InChIKey | CGIHFIDULQUVJG-UHFFFAOYSA-N |
| SMILES | C(O)C(O)C(C)(O)CCCC(C)CCCC(C)CCCC(C)C |
| LogP | 6.5 at 30℃ |
Description and Uses
Penetration enhancer in hair and skin care products.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H413 |
| Precautionary statements | P305+P351+P338 |
| WGK Germany | 3 |
| F | 10 |
| HS Code | 2905.49.5001 |
| Storage Class | 10 - Combustible liquids |
| REACH Registrations | Active |
