A6923412
Phytantriol (mixture of isomers) , >95.0%(GC) , 74563-64-7
CAS NO.:74563-64-7
Empirical Formula: C20H42O3
Molecular Weight: 330.55
MDL number: MFCD00129085
EINECS: 277-923-2
| Pack Size | Price | Stock | Quantity |
| 200mg | RMB172.00 | In Stock |
|
| 1G | RMB559.20 | In Stock |
|
| 5G | RMB1519.20 | In Stock |
|
| 25G | RMB3839.20 | In Stock |
|
| 100G | RMB7199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 56-57° |
| Boiling point: | 130 °C0.01 mm Hg(lit.) |
| Density | 0.932 g/mL at 25 °C(lit.) |
| vapor pressure | 0Pa at 25℃ |
| refractive index | n |
| Flash point: | 199 °C |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly) |
| form | liquid (viscous) |
| pka | 14.40±0.29(Predicted) |
| color | Clear Colorless |
| Water Solubility | 352μg/L at 20℃ |
| Merck | 14,7386 |
| InChI | InChI=1S/C20H42O3/c1-16(2)9-6-10-17(3)11-7-12-18(4)13-8-14-20(5,23)19(22)15-21/h16-19,21-23H,6-15H2,1-5H3 |
| InChIKey | CGIHFIDULQUVJG-UHFFFAOYSA-N |
| SMILES | C(O)C(O)C(C)(O)CCCC(C)CCCC(C)CCCC(C)C |
| LogP | 6.5 at 30℃ |
Description and Uses
Penetration enhancer in hair and skin care products.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H413 |
| Precautionary statements | P305+P351+P338 |
| WGK Germany | 3 |
| F | 10 |
| HS Code | 2905.49.5001 |





