A6925312
Pentaerythritol Tetrabenzoate , >95.5%(HPLC) , 4196-86-5
CAS NO.：4196-86-5
Empirical Formula: C33H28O8
Molecular Weight: 552.57
MDL number: MFCD00020676
EINECS: 224-079-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB31.20 | In Stock |
|
| 5G | RMB39.20 | In Stock |
|
| 25G | RMB135.20 | In Stock |
|
| 100g | RMB471.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 102-104 °C(lit.) |
| Boiling point: | 583.14°C (rough estimate) |
| Density | 1.1594 (rough estimate) |
| vapor pressure | 0Pa at 20℃ |
| refractive index | 1.6000 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | solid |
| color | Off white solid |
| Odor | mild odor |
| Water Solubility | 10μg/L at 20℃ |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| InChI | 1S/C33H28O8/c34-29(25-13-5-1-6-14-25)38-21-33(22-39-30(35)26-15-7-2-8-16-26,23-40-31(36)27-17-9-3-10-18-27)24-41-32(37)28-19-11-4-12-20-28/h1-20H,21-24H2 |
| InChIKey | MINJAOUGXYRTEI-UHFFFAOYSA-N |
| SMILES | O=C(OCC(COC(=O)c1ccccc1)(COC(=O)c2ccccc2)COC(=O)c3ccccc3)c4ccccc4 |
| LogP | 6.2 at 25℃ |
| CAS DataBase Reference | 4196-86-5(CAS DataBase Reference) |
| EPA Substance Registry System | 2,2-Bis((benzoyloxy)methyl)-1,3-propanediol dibenzoate (4196-86-5) |
Description and Uses
Plasticizer
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | 3 |
| RTECS | RZ2605000 |
| TSCA | TSCA listed |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
| Toxicity | LD50 orl-rat: 10 g/kg NPIRI* 2,83,75 |
