A6927412
2-(1-Piperazinylcarbonyl)-1,4-benzodioxane Hydrochloride , >98.0%(HPLC) , 70918-74-0
Synonym(s):
N-(1,4-Benzodioxane-2-carbonyl)piperazine
CAS NO.:70918-74-0
Empirical Formula: C13H17ClN2O3
Molecular Weight: 284.74
MDL number: MFCD00729051
EINECS: 415-660-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB43.20 | In Stock |
|
| 5G | RMB120.00 | In Stock |
|
| 25G | RMB397.60 | In Stock |
|
| 100G | RMB1156.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 105-108°C |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | powder to crystal |
| color | White to Almost white |
| Stability: | Hygroscopic |
| Major Application | pharmaceutical |
| InChI | InChI=1S/C13H16N2O3.ClH/c16-13(15-7-5-14-6-8-15)12-9-17-10-3-1-2-4-11(10)18-12;/h1-4,12,14H,5-9H2;1H |
| InChIKey | TUKBWYXLYINULI-UHFFFAOYSA-N |
| SMILES | C12=CC=CC=C1OCC(C(=O)N1CCNCC1)O2.Cl |
| CAS DataBase Reference | 70918-74-0(CAS DataBase Reference) |
Description and Uses
1-[(2,3-Dihydro-1,4-benzodioxin-2-yl)carbonyl]piperazine Monohydrochloride (Doxazosin EP Impurity B) is an impurity of Doxazosin (D537500), a selective a1-adrenoceptor antagonist. Doxazosin relaxes smooth muscles of the prostate.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331-H373-H411 |
| Precautionary statements | P273-P280-P301+P310-P302+P352+P312-P304+P340+P311-P314 |
| target organs | Liver |
| Hazard Codes | T;N,Xi,N,T |
| Risk Statements | 23/24/25-48/22-51/53 |
| Safety Statements | 45-53-61 |
| RIDADR | UN2811 - class 6.1 - PG 3 - EHS - Toxic solids, organic, n.o.s., HI: all |
| WGK Germany | WGK 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2934990002 |
| Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Chronic 2 STOT RE 2 Oral |








