PRODUCT Properties
| Melting point: | >300 °C (dec.)(lit.) |
| Boiling point: | 590.15°C (rough estimate) |
| Density | 1.6931 (rough estimate) |
| refractive index | 1.9320 (estimate) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | DMF: soluble |
| Colour Index | 74100 |
| form | Powder |
| color | blue black |
| Water Solubility | Insoluble in water. |
| λmax | 698 nm |
| BRN | 378323 |
| InChIKey | IEQIEDJGQAUEQZ-UHFFFAOYSA-N |
| SMILES | C1C2=C(C3N([H])C2=NC2=NC(C4=C2C=CC=C4)=NC2N([H])C(=C4C=2C=CC=C4)N=C2N=C(C4=C2C=CC=C4)N=3)C=CC=1 |c:19,33,t:7,45| |
| LogP | 9.620 (est) |
| EPA Substance Registry System | 29H,31H-Phthalocyanine (574-93-6) |
Description and Uses
Phthalocyanine is a common macrocylic blue-green dye able to form coordination complexes with many elements on the periodic table.
Safety
| Symbol(GHS) |  GHS07 |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29339900 |
| Hazardous Substances Data | 574-93-6(Hazardous Substances Data) |
