A6932812
Phenyl 1-Hydroxy-2-naphthoate , >98.0% , 132-54-7
Synonym(s):
1-Hydroxy-2-naphthoic acid phenyl ester;2-Phenoxycarbonyl-1-naphthol;Phenyl 1-hydroxy-2-naphthalate;Phenyl 1-hydroxy-2-naphthoate
CAS NO.:132-54-7
Empirical Formula: C17H12O3
Molecular Weight: 264.28
MDL number: MFCD00014310
EINECS: 205-065-0
| Pack Size | Price | Stock | Quantity |
| 25G | RMB155.20 | In Stock |
|
| 100G | RMB390.40 | In Stock |
|
| 500G | RMB1252.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 94-96 °C (lit.) |
| Boiling point: | 367.51°C (rough estimate) |
| Density | 1.1852 (rough estimate) |
| refractive index | 1.5490 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 7.71±0.50(Predicted) |
| color | White to Light yellow |
| BRN | 2217072 |
| InChI | 1S/C17H12O3/c18-16-14-9-5-4-6-12(14)10-11-15(16)17(19)20-13-7-2-1-3-8-13/h1-11,18H |
| InChIKey | QHDYIMWKSCJTIM-UHFFFAOYSA-N |
| SMILES | Oc1c(ccc2ccccc12)C(=O)Oc3ccccc3 |
| CAS DataBase Reference | 132-54-7(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Naphthalenecarboxylic acid, 1-hydroxy-, phenyl ester (132-54-7) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29182900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




