A6946658
Canrenone , 10mMinDMSO , 976-71-6
Synonym(s):
(17α)-17-Hydroxy-3-oxopregna-4,6-diene-21-carboxylic acid γ-lactone;Canrenone;NSC 261713
CAS NO.：976-71-6
Empirical Formula: C22H28O3
Molecular Weight: 340.46
MDL number: MFCD08064191
EINECS: 213-554-5
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 158-1600C |
| alpha | D +24.5° (chloroform) |
| Boiling point: | 416.25°C (rough estimate) |
| Density | 1.1236 (rough estimate) |
| refractive index | 1.5000 (estimate) |
| storage temp. | room temp |
| solubility | DMSO: soluble20mg/mL, clear |
| form | powder |
| color | white to beige |
| optical activity | [α]/D +17 to +24°, c = 1 in chloroform-d |
| Water Solubility | 272.4ug/L(25 ºC) |
| InChI | InChI=1/C22H28O3/c1-20-9-5-15(23)13-14(20)3-4-16-17(20)6-10-21(2)18(16)7-11-22(21)12-8-19(24)25-22/h3-4,13,16-18H,5-12H2,1-2H3/t16-,17+,18+,20+,21+,22-/s3 |
| InChIKey | UJVLDDZCTMKXJK-MUWITHSMNA-N |
| SMILES | [C@@]12(CCC(=O)O1)CC[C@@]1([H])[C@]3([H])C=CC4=CC(=O)CC[C@]4(C)[C@@]3([H])CC[C@]21C |&1:0,8,10,20,22,26,r| |
| LogP | 2.54 at 25℃ |
| CAS DataBase Reference | 976-71-6 |
| NIST Chemistry Reference | Canrenone(976-71-6) |
Description and Uses
Inhibits aldosterone biosynthesis and blocks ouabain effects
Safety
| Symbol(GHS) |   GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H351-H411 |
| Precautionary statements | P280 |
| Hazard Codes | Xn,N |
| Risk Statements | 40-51/53 |
| Safety Statements | 36/37-61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| HazardClass | 9 |
| HS Code | 29329990 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
