A6946858
DL-m-Tyrosine , 10mMinWater , 775-06-4
Synonym(s):
(±)-2-Amino-3-(3-hydroxyphenyl)propionic acid;3-(3-Hydroxyphenyl)-DL -alanine
CAS NO.:775-06-4
Empirical Formula: C9H11NO3
Molecular Weight: 181.19
MDL number: MFCD00002597
EINECS: 212-270-9
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 280-285 °C (dec.) (lit.) |
| Boiling point: | 314.29°C (rough estimate) |
| Density | 1.2375 (rough estimate) |
| refractive index | 1.5270 (estimate) |
| storage temp. | Hygroscopic, -20°C Freezer, Under Inert Atmosphere |
| solubility | Soluble in 1M HCl. |
| pka | 2.20±0.10(Predicted) |
| form | crystalline |
| color | white to off-white |
| Merck | 14,9839 |
| BRN | 2416853 |
| Major Application | detection |
| InChI | InChI=1S/C9H11NO3/c10-8(9(12)13)5-6-2-1-3-7(11)4-6/h1-4,8,11H,5,10H2,(H,12,13)/t8-/m0/s1 |
| InChIKey | JZKXXXDKRQWDET-QMMMGPOBSA-N |
| SMILES | C(O)(=O)[C@H](CC1=CC=CC(O)=C1)N |
| CAS DataBase Reference | 775-06-4(CAS DataBase Reference) |
Description and Uses
A precursor in the formation of catecholamines
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| RTECS | YP2278000 |
| HS Code | 29225090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




