A6954158
4-Bromo-3-hydroxybenzoicacid , 10mMinDMSO , 14348-38-0
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 225-227 |
| Boiling point: | 338.6±32.0 °C(Predicted) |
| Density | 1.861±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Soluble in DMSO |
| form | solid |
| pka | 3.85±0.10(Predicted) |
| color | White |
| InChI | InChI=1S/C7H5BrO3/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,9H,(H,10,11) |
| InChIKey | PAJSESFUWIYFNF-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(Br)C(O)=C1 |
Description and Uses
Brocresine metabolite. Inhibitor of inhibited rat fetal and rat gastric histidine decarboxylase.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| Hazard Codes | Xi |
| Hazard Note | Irritant/Keep Cold |
| HS Code | 2918290090 |
![6,7-Dibromo-8-nitro-2,3-dihydrobenzo[b][1,4]dioxine-5-carboxylicacid](https://img.chemicalbook.com/CAS/GIF/66411-18-5.gif)
