A6954158
                    4-Bromo-3-hydroxybenzoicacid , 10mMinDMSO , 14348-38-0
| Pack Size | Price | Stock | Quantity | 
| 1ml | RMB159.20 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 225-227 | 
                                    
| Boiling point: | 338.6±32.0 °C(Predicted) | 
                                    
| Density | 1.861±0.06 g/cm3(Predicted) | 
                                    
| storage temp. | Inert atmosphere,Room Temperature | 
                                    
| solubility | Soluble in DMSO | 
                                    
| form | solid | 
                                    
| pka | 3.85±0.10(Predicted) | 
                                    
| color | White | 
                                    
| InChI | InChI=1S/C7H5BrO3/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,9H,(H,10,11) | 
                                    
| InChIKey | PAJSESFUWIYFNF-UHFFFAOYSA-N | 
                                    
| SMILES | C(O)(=O)C1=CC=C(Br)C(O)=C1 | 
                                    
Description and Uses
Brocresine metabolite. Inhibitor of inhibited rat fetal and rat gastric histidine decarboxylase.
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H315-H319-H335 | 
| Precautionary statements | P261-P271-P280 | 
| Hazard Codes | Xi | 
| Hazard Note | Irritant/Keep Cold | 
| HS Code | 2918290090 | 



![6,7-Dibromo-8-nitro-2,3-dihydrobenzo[b][1,4]dioxine-5-carboxylicacid](https://img.chemicalbook.com/CAS/GIF/66411-18-5.gif)



