A6954958
(+)-Catechin , 10mMinDMSO , 154-23-4
Synonym(s):
(+)-Catechin;(+)-Cyanidanol;D -Catechin
CAS NO.:154-23-4
Empirical Formula: C15H14O6
Molecular Weight: 290.27
MDL number: MFCD00075649
EINECS: 205-825-1
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 175-177 °C (anhydrous)(lit.) |
| Boiling point: | 352.36°C (rough estimate) |
| alpha | D18 +16 to +18.4° |
| Density | 1.2451 (rough estimate) |
| refractive index | 1.4359 (estimate) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly, Sonicated, Heated) |
| form | Solid |
| pka | 9.54±0.10(Predicted) |
| color | Light Orange to Light Brown |
| Merck | 14,1902 |
| Major Application | food and beverages |
| InChI | 1S/C15H14O6/c16-8-4-11(18)9-6-13(20)15(21-14(9)5-8)7-1-2-10(17)12(19)3-7/h1-5,13,15-20H,6H2/t13-,15+/m0/s1 |
| InChIKey | PFTAWBLQPZVEMU-DZGCQCFKSA-N |
| SMILES | O[C@H]1Cc2c(O)cc(O)cc2O[C@@H]1c3ccc(O)c(O)c3 |
| LogP | 0.510 |
| CAS DataBase Reference | 154-23-4 |
| EPA Substance Registry System | 2H-1-Benzopyran-3,5,7-triol, 2-(3,4-dihydroxyphenyl)-3,4-dihydro-, (2R,3S)- (154-23-4) |
Description and Uses
Labelled (+)-Catechin (C217500). (+)-Catechin is a flavonoid found primarily in higher woody plants as (+)-Catechin along with (-)-Epicatechin (cis form). Antidiarrheal.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | DJ3450000 |
| F | 8-10-23 |
| HS Code | 29329990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity | LD50 oral in rat: > 10gm/kg |




