A6955258
Elaidicacid , 10mMinDMSO , 112-79-8
Synonym(s):
trans-9-Octadecenoic acid;trans-Oleic acid;Oleic acid
CAS NO.:112-79-8
Empirical Formula: C18H34O2
Molecular Weight: 282.46
MDL number: MFCD00063954
EINECS: 204-006-6
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 42-44 °C (lit.) |
| Boiling point: | 288 °C/100 mmHg (lit.) |
| Density | 0.8734 g/cm3 (20 ºC) |
| refractive index | 1.4597 (589.3 nm 20℃) |
| Flash point: | >230 °F |
| storage temp. | -20°C |
| solubility | Chloroform, Ethyl Acetate (Slightly) |
| form | Liquid |
| pka | 4.78±0.10(Predicted) |
| Specific Gravity | 0.851 (79℃) |
| color | Off-White |
| biological source | semisynthetic |
| Water Solubility | Insoluble in water. |
| Sensitive | Air Sensitive |
| Merck | 14,3533 |
| BRN | 1726543 |
| InChI | 1S/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3,(H,19,20)/b10-9+ |
| InChIKey | ZQPPMHVWECSIRJ-MDZDMXLPSA-N |
| SMILES | CCCCCCCC\C=C\CCCCCCCC(O)=O |
| LogP | 7.698 (est) |
| CAS DataBase Reference | 112-79-8(CAS DataBase Reference) |
Description and Uses
Elaidic acid is the major trans fat found in hydrogenated vegetable oils and occurs in small amounts in caprine and bovine milk (very roughly 0.1% of the fatty acids) and some meats. It is the trans isomer of oleic acid. The name of the elaidinization reaction comes from elaidic acid.
Elaidic acid increases CETP activity, which in turn raises VLDL and lowers HDL cholesterol.
Elaidic acid is the major trans fat found in hydrogenated vegetable oils. It increases CETP activity, which in turn raises VLDL and lowers HDL cholesterol.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 1 |
| RTECS | JX6125000 |
| F | 9 |
| HS Code | 2916.19.3000 |
| Storage Class | 11 - Combustible Solids |
| Toxicity | mouse,LD50,intravenous,100mg/kg (100mg/kg),U.S. Army Armament Research & Development Command, Chemical Systems Laboratory, NIOSH Exchange Chemicals. Vol. NX#00371, |






