A6956112
PF-06463922 acetate , 98%(HPLC) , 1454846-35-5
CAS NO.：1454846-35-5
Empirical Formula: C21H19FN6O2
Molecular Weight: 406.41
MDL number:
EINECS: 813-704-5
| Pack Size | Price | Stock | Quantity |
| 5MG | RMB79.20 | In Stock |
|
| 10mg | RMB127.20 | In Stock |
|
| 25mg | RMB279.20 | In Stock |
|
| 50mg | RMB495.20 | In Stock |
|
| 100mg | RMB879.20 | In Stock |
|
| 250mg | RMB2159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 184-187°C |
| Boiling point: | 675.0±55.0 °C(Predicted) |
| Density | 1.42±0.1 g/cm3(Predicted) |
| storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Solid |
| pka | 6.05±0.40(Predicted) |
| color | White to Off-White |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C21H19FN6O2/c1-11-15-7-13(22)4-5-14(15)21(29)27(2)10-16-19(17(8-23)28(3)26-16)12-6-18(30-11)20(24)25-9-12/h4-7,9,11H,10H2,1-3H3,(H2,24,25)/t11-/m1/s1 |
| InChIKey | IIXWYSCJSQVBQM-LLVKDONJSA-N |
| SMILES | [C@@H]1(C)C2=CC(F)=CC=C2C(=O)N(C)CC2=NN(C)C(C#N)=C2C2C=C(C(N)=NC=2)O1 |
Description and Uses
PF- 06463922 is a potent and selective ROS1/ALK inhibitor capable to block crizotinib-resistant ROS1 mutations. Used in the treatment of human cancers.
Safety
| Symbol(GHS) |  GHS08 |
| Signal word | Warning |
| Hazard statements | H341-H373 |
| Precautionary statements | P260-P314-P501-P201-P202-P281-P308+P313-P405-P501 |
