A6957758
Dehydrocholicacid , 10mMinDMSO , 81-23-2
Synonym(s):
(5β)-3,7,12-Trioxocholan-24-oic acid;3,7,12-Trioxo-5β-cholanic acid;5β-Cholanic acid-3,5,12-trione;5β-cholanic acid-3,7,12-trione;5?-cholanic acid-3,7,12-trione
CAS NO.:81-23-2
Empirical Formula: C24H34O5
Molecular Weight: 402.53
MDL number: MFCD00066410
EINECS: 201-335-7
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 238-240 °C |
| alpha | 29 º (c=2, dioxane) |
| Boiling point: | 444.65°C (rough estimate) |
| Density | 1.0687 (rough estimate) |
| vapor pressure | 0.013Pa at 20℃ |
| refractive index | 30.5 ° (C=2, Dioxane) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | ethanol: 10 mg/mL |
| form | Solid |
| pka | pKa 5.12(H2O
t = 20
c > CMC) (Uncertain) |
| color | White to Off-White |
| biological source | bovine bile synthetic |
| optical activity | [α]20/D +26±1°, c =1% in ethanol |
| Water Solubility | 65mg/L(30 ºC) |
| Merck | 14,2868 |
| BRN | 3226734 |
| Major Application | pharmaceutical (small molecule) |
| InChIKey | OHXPGWPVLFPUSM-KLRNGDHRSA-N |
| SMILES | [H][C@@]12CC(=O)CC[C@]1(C)[C@@]3([H])CC(=O)[C@]4(C)[C@H](CC[C@@]4([H])[C@]3([H])C(=O)C2)[C@H](C)CCC(O)=O |
| LogP | 1.64 at 22℃ and pH5.7 |
| Surface tension | 56.9mN/m at 63mg/L and 20℃ |
| CAS DataBase Reference | 81-23-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Dehydrocholic acid(81-23-2) |
| EPA Substance Registry System | Cholan-24-oic acid, 3,7,12-trioxo-, (5.beta.)- (81-23-2) |
Description and Uses
antibacterial
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H303 |
| Precautionary statements | P270-P301+P312-P403-P501c |
| Safety Statements | 24/25 |
| WGK Germany | 2 |
| RTECS | FZ2300000 |
| TSCA | TSCA listed |
| HS Code | 2918300000 |
| Storage Class | 11 - Combustible Solids |



