A6958458
Bay11-7085 , 10mMinDMSO , 196309-76-9
Synonym(s):
(E)-3-(4-t-Butylphenylsulfonyl)-2-propenenitrile
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB697.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 80-82℃ |
| Boiling point: | 407.1±45.0 °C(Predicted) |
| Density | 1.144 |
| Flash point: | 200℃ |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO: >25 mg/mL, soluble |
| form | solid |
| color | white |
| Sensitive | Light Sensitive |
| InChI | 1S/C13H15NO2S/c1-13(2,3)11-5-7-12(8-6-11)17(15,16)10-4-9-14/h4-8,10H,1-3H3/b10-4+ |
| InChIKey | VHKZGNPOHPFPER-ONNFQVAWSA-N |
| SMILES | CC(C)(C)c1ccc(cc1)S(=O)(=O)\C=C\C#N |
| CAS DataBase Reference | 196309-76-9 |
Description and Uses
In the classical pathway of NF-κB activation, phosphorylation of the inhibitor of NF-κB (IκBα) releases the inhibitor from NF-κB, allowing IκBα degradation and NF-κB activation and nuclear import. BAY-11-7085 is an irreversible inhibitor of IκBα phosphorylation, preventing activation of NF-κB by cytokines and lipopolysaccharide (IC50 = 10 μM). It blocks gene expression that is regulated through the classical pathway of NF-κB activation and in this way blocks apoptosis, cell adhesion, and inflammation. BAY-11-7085 is also used to study IκBα actions that are independent of NF-κB signaling.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| RTECS | UD1312500 |
| HS Code | 29309090 |
| Storage Class | 11 - Combustible Solids |
