A6967812
Perfluoro-<WBR>1,3-<WBR>dimethylcyclohexane , 80% , 335-27-3
Synonym(s):
Decafluoro-1,3-bis(trifluoromethyl)cyclohexane;Hexadecafluoro-1,3-dimethylcyclohexane;Hexadecafluoro-1,3-dimethylcyclohexane (cis+trans)
CAS NO.:335-27-3
Empirical Formula: C8F16
Molecular Weight: 400.06
MDL number: MFCD00001469
EINECS: 206-386-9
| Pack Size | Price | Stock | Quantity |
| 50G | RMB331.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -55 °C (lit.) |
| Boiling point: | 101-102 °C (lit.) |
| Density | 1.828 g/mL at 25 °C (lit.) |
| vapor density | 14 (vs air) |
| vapor pressure | 47.2hPa at 25℃ |
| refractive index | n |
| Flash point: | None |
| form | Liquid |
| Specific Gravity | 1.828 |
| BRN | 2064147 |
| Cosmetics Ingredients Functions | SOLVENT |
| InChI | 1S/C8F16/c9-1(7(19,20)21)3(11,12)2(10,8(22,23)24)5(15,16)6(17,18)4(1,13)14 |
| InChIKey | LOQGSOTUHASIHI-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C1(F)F |
| LogP | 666 at 25℃ |
| CAS DataBase Reference | 335-27-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Perfluoro-1,3-dimethylcyclohexane(335-27-3) |
| EPA Substance Registry System | Cyclohexane, 1,1,2,2,3,3,4,5,5,6-decafluoro-4,6-bis(trifluoromethyl)- (335-27-3) |
Description and Uses
Perfluoro-1,3-dimethylcyclohexane has been used in:
- the preparation of amorphous fluorocarbon films by plasma polymerization
- hydroformylation of linear terminal alkenes using rhodium based catalysts under fluorous biphasic conditions in the presence and absence of toluene
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | GV4990000 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 29038900 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





