PRODUCT Properties
| Melting point: | 74-75 °C(Solv: benzene (71-43-2)) |
| Boiling point: | 129-130 °C/744 mmHg (lit.) |
| Density | 1.744 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Store below +30°C. |
| Water Solubility | Reacts with water. |
| Sensitive | Moisture Sensitive |
| BRN | 1809677 |
| InChI | 1S/C8ClF15O/c9-1(25)2(10,11)3(12,13)4(14,15)5(16,17)6(18,19)7(20,21)8(22,23)24 |
| InChIKey | AQQBRCXWZZAFOK-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(Cl)=O |
| CAS DataBase Reference | 335-64-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Perfluorooctanoyl chloride(335-64-8) |
| EPA Substance Registry System | Pentadecafluorooctyl chloride (335-64-8) |
Description and Uses
Perfluorooctanoyl chloride is derivatizated and used in the determination of Amphetamine and Methamphetamine in Blood. It can be used in agrochemical, pharmaceutical and dyestuff field .
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302+H332-H351-H360D-H362-H372 |
| Precautionary statements | P201-P202-P263-P301+P312-P304+P340+P312-P308+P313 |
| target organs | Liver |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29159080 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Carc. 2 Eye Dam. 1 Lact. Repr. 1B STOT RE 1 |




