PRODUCT Properties
| Melting point: | 108-112 °C(lit.) |
| alpha | D20 +5.5° -14.0° (c = 0.82 in water) |
| Boiling point: | 191.65°C (rough estimate) |
| Density | 1.545 |
| refractive index | 1.3920 (estimate) |
| storage temp. | Refrigerator |
| solubility | H2O: 50 mg/mL, clear, colorless |
| form | Crystalline Powder |
| pka | 12.46±0.20(Predicted) |
| color | White to slightly yellow |
| optical activity | [α]25/D 13.8°, c = 4 in H2O |
| Water Solubility | Water (Slightly) |
| Sensitive | Hygroscopic |
| Merck | 14,5641 |
| BRN | 1723083 |
| InChI | 1S/C5H10O5/c6-2-1-10-5(9)4(8)3(2)7/h2-9H,1H2/t2-,3+,4+,5?/m1/s1 |
| InChIKey | SRBFZHDQGSBBOR-AGQMPKSLSA-N |
| SMILES | O[C@@H]1COC(O)[C@@H](O)[C@H]1O |
| LogP | -2.390 (est) |
| CAS DataBase Reference | 1114-34-7(CAS DataBase Reference) |
| EPA Substance Registry System | D-Lyxose (1114-34-7) |
Description and Uses
D-LYXOSE is a useful carbohydrate synthon.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H319-H225 |
| Precautionary statements | P501-P240-P210-P233-P243-P241-P242-P264-P280-P370+P378-P337+P313-P305+P351+P338-P303+P361+P353-P332+P313-P362-P403+P235 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36/37/39-26 |
| WGK Germany | 3 |
| F | 3-10 |
| TSCA | TSCA listed |
| HS Code | 29400090 |
| Storage Class | 11 - Combustible Solids |







