A6972958
Amarogentin , 10mMinDMSO , 21018-84-8
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB622.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 229-230° (monohydrate) |
| alpha | D20 -116.6° (methanol) |
| Boiling point: | 928.5±65.0 °C(Predicted) |
| Density | 1.59±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMF: 1 mg/ml; DMSO: 2 mg/ml; PBS (pH 7.2): 0.1 mg/ml |
| form | A crystalline solid |
| pka | 7.42±0.40(Predicted) |
| color | White to off-white |
| Major Application | food and beverages |
| InChIKey | FWSMZQZCMSGCCU-WKYWRJDANA-N |
| SMILES | [C@@]12([H])CCOC(=O)C1=CO[C@@H](OC[C@@H]1[C@@H](O)[C@@H]([C@@H](O)[C@H](OC(=O)C3=CC(=C(C4C=CC=C(O)C=4)C(O)=C3)O)O1)O)[C@@H]2C=C |&1:0,10,13,14,16,17,19,40,r| |
| LogP | 2.503 (est) |
Description and Uses
Amarogentin has the functions of protecting liver and gallbladder, inhibiting bacteria and diuretic.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |






![Ethyl[1,1''-biphenyl]-4-carboxylate](https://img.chemicalbook.com/CAS/GIF/6301-56-0.gif)