3,4-Dihydroxyhydrocinnamicacid , 10mMinDMSO , 1078-61-1
Synonym(s):
3-(3,4-Dihydroxyphenyl)propionic acid;Hydrocaffeic acid
CAS NO.:1078-61-1
Empirical Formula: C9H10O4
Molecular Weight: 182.17
MDL number: MFCD00002776
EINECS: 214-083-8
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 136-139 °C(lit.) |
| Boiling point: | 418℃ |
| Density | 1.398 |
| Flash point: | 220℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 4.75±0.10(Predicted) |
| color | Pale Beige to Pale Brown |
| Water Solubility | Slightly soluble in water. |
| BRN | 2213449 |
| InChI | InChI=1S/C9H10O4/c10-7-3-1-6(5-8(7)11)2-4-9(12)13/h1,3,5,10-11H,2,4H2,(H,12,13) |
| InChIKey | DZAUWHJDUNRCTF-UHFFFAOYSA-N |
| SMILES | C1(CCC(O)=O)=CC=C(O)C(O)=C1 |
| LogP | 0.115 (est) |
| CAS DataBase Reference | 1078-61-1(CAS DataBase Reference) |
Description and Uses
Dihydrocaffeic acid is a polyphenol that has diverse biological activities, including antioxidant, neuroprotective, and enzyme inhibitory properties. Dihydrocaffeic acid scavenges ABTS (; IC50 = 81.86 μg/ml) and 2,2-diphenyl-1-picrylhydrazyl (DPPH; ; IC50 = 192.86 μg/ml) radicals and increases the survival of RGC-5 mouse retinal ganglion cells under hypoxic conditions and in the presence of S-nitroso-N-acetyl-D,L-penicillamine (SNAP; ) in a concentration-dependent manner. It also decreases endothelial nitric oxide synthase (eNOS) activity in EA.hy926 human endothelial cells in a concentration-dependent manner. In vivo, dihydrocaffeic acid (30 mg/kg) decreases infarct size in a rat model of transient ischemia induced by middle cerebral artery occlusion (MCAO).
3-(3,4-Dihydroxyphenyl)propionic acid it can be used to produce 3-(3,4-dihydroxy-phenyl)-propionic acid octyl ester by heating.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | MW5143500 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






