PRODUCT Properties
| Melting point: | 296-299 °C (lit.) |
| Boiling point: | 472.1±14.0 °C(Predicted) |
| Density | 1.456±0.06 g/cm3(Predicted) |
| storage temp. | -20°C Freezer, Under inert atmosphere |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 7.29±0.20(Predicted) |
| form | Solid |
| color | Off-White to Pale Green |
| Sensitive | Light Sensitive |
| λmax | 322nm(MeOH)(lit.) |
| BRN | 179133 |
| InChI | 1S/C10H8O4/c1-5-2-9(13)14-8-4-6(11)3-7(12)10(5)8/h2-4,11-12H,1H3 |
| InChIKey | QNVWGEJMXOQQPM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)Oc2cc(O)cc(O)c12 |
| CAS DataBase Reference | 2107-76-8(CAS DataBase Reference) |
| EPA Substance Registry System | 5,7-Dihydroxy-4-methylcoumarin (2107-76-8) |
Description and Uses
5,7-Dihydroxy-4-methylcoumarin may be used in the synthesis of pyrano[2,3-h]coumarin derivatives and 5,7-dihydroxy-8-formyl-4-methylcoumarin.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312+P330 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29321900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
| Hazardous Substances Data | 2107-76-8(Hazardous Substances Data) |
