A6977058
(-)-Chicoricacid , 10mMinDMSO , 70831-56-0
Synonym(s):
(2R,3R)-2,3-Bis{[(2E)-3-(3,4-dihydroxyphenyl)-1-oxo-2-propen-1-yl]oxy}butanedioic acid;2,3-Di-trans-caffeoyltartaric acid
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 206°C(lit.) |
| Boiling point: | 46-47 °C |
| Density | 1.641±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | DMSO: 100 mg/mL (210.81 mM) |
| form | powder to crystal |
| pka | 1.42±0.25(Predicted) |
| color | White to Light yellow to Light orange |
| λmax | 327nm(lit.) |
| Major Application | food and beverages |
| InChIKey | YDDGKXBLOXEEMN-IABMMNSOSA-N |
| SMILES | C(O)(=O)[C@H](OC(=O)/C=C/C1=CC=C(O)C(O)=C1)[C@@H](OC(=O)/C=C/C1=CC=C(O)C(O)=C1)C(O)=O |
| CAS DataBase Reference | 70831-56-0(CAS DataBase Reference) |
Description and Uses
food and beverages
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22-42/43 |
| Safety Statements | 22-36/37-45-24/25 |
| WGK Germany | 3 |
| RTECS | EJ9852090 |
| HS Code | 29182900 |
| Storage Class | 11 - Combustible Solids |





