Atropine , 10mMinDMSO , 51-55-8
Synonym(s):
Atropine;Atropine solution;endo-(±)-α-(Hydroxymethyl)benzeneacetic acid 8-methyl-8-azabicyclo[3.2.1]oct-3-yl ester;Hyoscyamine;Tropine tropate
CAS NO.:51-55-8
Empirical Formula: C17H23NO3
Molecular Weight: 289.37
MDL number: MFCD00022622
EINECS: 200-104-8
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB559.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 115-118 °C |
| Boiling point: | 431.53°C (rough estimate) |
| Density | 1.0470 (rough estimate) |
| refractive index | 1.5200 (estimate) |
| Flash point: | 2℃ |
| storage temp. | -20°C |
| solubility | H2O: 2 mg/mL |
| form | powder |
| pka | 9.7(at 21℃) |
| color | white |
| Water Solubility | 1.6g/L(18 ºC) |
| Sensitive | Light Sensitive |
| Merck | 14,875 |
| BRN | 91260 |
| Major Application | pharmaceutical |
| InChI | 1S/C17H23NO3/c1-18-13-7-8-14(18)10-15(9-13)21-17(20)16(11-19)12-5-3-2-4-6-12/h2-6,13-16,19H,7-11H2,1H3/t13-,14+,15+,16? |
| InChIKey | RKUNBYITZUJHSG-SPUOUPEWSA-N |
| SMILES | CN1[C@H]2CC[C@@H]1C[C@@H](C2)OC(=O)C(CO)c3ccccc3 |
| CAS DataBase Reference | 51-55-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Atropine(51-55-8) |
| EPA Substance Registry System | Atropine (51-55-8) |
Description and Uses
Atropine is a naturally occurring tropane alkaloid extracted from plants of the family Solanaceae including deadly nightshade (A. belladonna). It is a non-
Scopolamine is found in the leaves of Daturametel L., D. meteloides L., and D. fastuosavar. alba (Cordell 1978). It is used as asedative, a preanesthetic agent, and in thetreatment of motion sickness (Merck 1989).
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H300+H330 |
| Precautionary statements | P260-P264-P270-P271-P284-P304+P340+P310 |
| Hazard Codes | T+,Xn,F |
| Risk Statements | 26/28-36/37/38-20/21/22-36-11 |
| Safety Statements | 25-45-36-26-36/37-16 |
| RIDADR | 1544 |
| WGK Germany | 3 |
| RTECS | CK0700000 |
| F | 8-10-23 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29399900 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Inhalation Acute Tox. 2 Oral |
| Hazardous Substances Data | 51-55-8(Hazardous Substances Data) |
| Toxicity | LD50 orally in rats: 750 mg/kg (Cahen, Tvede) |




