PRODUCT Properties
| Melting point: | 162-164 °C |
| Boiling point: | 465.27°C (rough estimate) |
| Density | 1.2223 (rough estimate) |
| refractive index | 1.5000 (estimate) |
| storage temp. | 2-8°C |
| solubility | Acetonitrile (Slightly), Ethyl Acetate (Slightly, Heated), Methanol (Slightly) |
| form | Solid |
| pka | 9.75±0.20(Predicted) |
| color | Yellow to Dark Brown |
| Merck | 13,1316 |
| BRN | 94036 |
| Major Application | food and beverages forensics and toxicology veterinary |
| InChI | 1S/C19H21NO4/c1-20-5-4-10-7-15(22)19(24-3)18-12-9-16(23-2)14(21)8-11(12)6-13(20)17(10)18/h7-9,13,21-22H,4-6H2,1-3H3/t13-/m0/s1 |
| InChIKey | LZJRNLRASBVRRX-ZDUSSCGKSA-N |
| SMILES | COc1cc-2c(CC3N(C)CCc4cc(O)c(OC)c-2c34)cc1O |
| LogP | 0.837 (est) |
| CAS DataBase Reference | 476-70-0(CAS DataBase Reference) |
| EPA Substance Registry System | 4H-Dibenzo[de,g]quinoline-2,9-diol, 5,6,6a,7-tetrahydro-1,10-dimethoxy-6-methyl-, (6aS)- (476-70-0) |
Description and Uses
antineoplastic
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P301+P312+P330-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 1-20-24/25-45-36-26 |
| RIDADR | 1544 |
| WGK Germany | 3 |
| RTECS | CE0750000 |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29399990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
