A6981112
propan-2-yl (2S)-2-{[(S)-pentafluorophenoxy(phenoxy)phosphoryl]amino}propanoate , 97% , 1334513-02-8
CAS NO.:1334513-02-8
Empirical Formula: C18H17F5NO5P
Molecular Weight: 453.3
MDL number: MFCD22665799
EINECS: 695-076-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB68.00 | In Stock |
|
| 25g | RMB227.20 | In Stock |
|
| 100g | RMB599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 133-135°C |
| Boiling point: | 442.6±55.0 °C(Predicted) |
| Density | 1.405 |
| vapor pressure | 0Pa at 25℃ |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | -3.81±0.70(Predicted) |
| color | White |
| InChI | InChI=1/C18H17F5NO5P/c1-9(2)27-18(25)10(3)24-30(26,28-11-7-5-4-6-8-11)29-17-15(22)13(20)12(19)14(21)16(17)23/h4-10H,1-3H3,(H,24,26)/t10-,30/s3 |
| InChIKey | MIILDBHEJQLACD-YPKMSJFYNA-N |
| SMILES | C(OC(C)C)(=O)[C@H](C)NP(OC1=C(F)C(F)=C(F)C(F)=C1F)(OC1=CC=CC=C1)=O |&1:6,r| |
| LogP | 4.1 at 30℃ and pH7.37 |
Description and Uses
N-[(S)-(2,3,4,5,6-Pentafluorophenoxy)phenoxyphosphinyl]-L-alanine 1-Methylethyl Ester is a reactant in the synthesis of phosphoramidate imidazo[2,1-f][1,2,4]triazine-4-amine adenosine prodrugs that can increase anti-HCV activity.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P280-P305+P351+P338-P310 |
| HS Code | 2931599090 |
| REACH Registrations | Active |

![propan-2-yl (2S)-2-{[(S)-pentafluorophenoxy(phenoxy)phosphoryl]amino}propanoate](https://img.chemicalbook.com/CAS/GIF/1334513-02-8.gif)





