A6988158
Cyanidol3-Glucoside , 10mMinDMSO , 7084-24-4
Synonym(s):
Asterin;Chrysanthemin;Cyanidin 3-O-glucoside chloride;Glucocyanidin chloride;Kuromanin chloride
CAS NO.:7084-24-4
Empirical Formula: C21H21ClO11
Molecular Weight: 484.84
MDL number: MFCD27665410
EINECS: 230-384-7
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | -20°C |
| solubility | Acidic Methanol (Slightly), Water (Slightly) |
| form | Solid |
| color | Dark Red to Black |
| Stability: | Hygroscopic |
| InChIKey | YTMNONATNXDQJF-UBNZBFALSA-N |
| SMILES | O([C@H]1[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O1)O)C1=CC2=C(C=C(O)C=C2[O+]=C1C1C=CC(O)=C(O)C=1)O.[Cl-] |&1:1,2,3,5,7,r| |
Description and Uses
Cyanidol 3-Glucoside is a anthocyanin that is naturally occurring in various fruits, vegetable and plants. Cyanidol 3-Glucoside is known to exhibit high antioxidant capacity and neuroprotective effects by triggering mobilization of cellular free sialic acid and utilizing it as an additional biological antioxidant in brain neural cells.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| RTECS | DK1270000 |
| HS Code | 29389090 |




