A7001658
2,4-Dihydroxypyrimidine-5-carboxylicacid , 10mMinDMSO , 23945-44-0
Synonym(s):
Isoorotic acid;Uracil-5-carboxylic acid
CAS NO.：23945-44-0
Empirical Formula: C5H4N2O4
Molecular Weight: 156.1
MDL number: MFCD00006023
EINECS: 245-947-2
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 283 °C (dec.)(lit.) |
| Boiling point: | 280.29°C (rough estimate) |
| Density | 1.6814 (rough estimate) |
| refractive index | 1.4800 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Soluble in DMSO |
| form | Crystalline Powder |
| pka | 5.08±0.20(Predicted) |
| color | White to slightly yellow |
| Water Solubility | 1.8g/L(20 ºC) |
| InChI | InChI=1S/C5H4N2O4/c8-3-2(4(9)10)1-6-5(11)7-3/h1H,(H,9,10)(H2,6,7,8,11) |
| InChIKey | ZXYAAVBXHKCJJB-UHFFFAOYSA-N |
| SMILES | C1(=O)NC=C(C(O)=O)C(=O)N1 |
| CAS DataBase Reference | 23945-44-0(CAS DataBase Reference) |
| EPA Substance Registry System | 5-Pyrimidinecarboxylic acid, 1,2,3,4-tetrahydro-2,4-dioxo- (23945-44-0) |
Description and Uses
2,4-Dihydroxypyrimidine-5-carboxylic acid (Uracil-5-carboxylic acid) has been used for the visual sensing of melamine (at parts-per-billion (ppb) level) by a highly sensitive analytical method based on Au nanoparticles.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29335990 |
