A7006058
Amoxicillin , 10mMinDMSO , 26787-78-0
Synonym(s):
Amoxicillin trihydrate
CAS NO.:26787-78-0
Empirical Formula: C16H19N3O5S
Molecular Weight: 365.4
MDL number: MFCD00072029
EINECS: 248-003-8
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 140 °C |
| Boiling point: | 743.2±60.0 °C(Predicted) |
| Density | 1.54±0.1 g/cm3(Predicted) |
| vapor pressure | 0Pa at 25℃ |
| storage temp. | 2-8°C |
| pka | pKa 2.4 (Uncertain) |
| form | solid |
| color | Light yellow |
| Water Solubility | 4g/L at 25℃ |
| Merck | 13,582 |
| BRN | 7507120 |
| BCS Class | 1,3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | 1S/C16H19N3O5S/c1-16(2)11(15(23)24)19-13(22)10(14(19)25-16)18-12(21)9(17)7-3-5-8(20)6-4-7/h3-6,9-11,14,20H,17H2,1-2H3,(H,18,21)(H,23,24)/t9-,10-,11+,14-/m1/s1 |
| InChIKey | LSQZJLSUYDQPKJ-UWFZAAFLSA-N |
| SMILES | CC1(C)S[C@@H]2[C@H](NC(=O)[C@H](N)c3ccc(O)cc3)C(=O)N2[C@H]1C(O)=O |
| LogP | 0.87 at 25℃ |
| CAS DataBase Reference | 26787-78-0(CAS DataBase Reference) |
| EPA Substance Registry System | 4-Thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, 6-[[(2R)-2-amino-2-(4-hydroxyphenyl)acetyl]amino]-3,3-dimethyl-7-oxo-, (2S,5R,6R)- (26787-78-0) |
Description and Uses
Amoxicillin is an antibiotic used in the treatment of various bacterial infections.
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Danger |
| Hazard statements | H317-H334 |
| Precautionary statements | P261-P280-P342+P311 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 42/43 |
| Safety Statements | 22-36/37 |
| WGK Germany | 2 |
| RTECS | XH8300000 |
| HS Code | 29411000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Resp. Sens. 1 Skin Sens. 1 |
| Hazardous Substances Data | 26787-78-0(Hazardous Substances Data) |




