PRODUCT Properties
| Melting point: | 181° |
| alpha | D21 -163.1° (c = 1.6) |
| Boiling point: | 669.0±55.0 °C(Predicted) |
| Density | 1.61±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMF: 30 mg/ml; DMSO: 30 mg/ml; PBS (pH 7.2): 10 mg/ml |
| form | Solid |
| pka | 12.80±0.70(Predicted) |
| color | White |
| optical activity | -16518 (H2O) |
| BRN | 50340 |
| InChI | InChI=1/C15H22O9/c16-4-6-3-8(18)7-1-2-22-14(10(6)7)24-15-13(21)12(20)11(19)9(5-17)23-15/h1-3,7-21H,4-5H2/t7-,8+,9+,10+,11+,12-,13+,14-,15-/s3 |
| InChIKey | RJWJHRPNHPHBRN-FKVJWERZSA-N |
| SMILES | [C@@]12([H])C(CO)=C[C@@H](O)[C@]1([H])C=CO[C@H]2O[C@H]1[C@H](O)[C@H]([C@H](O)[C@@H](CO)O1)O |&1:0,6,8,13,15,16,18,19,21,r| |
| LogP | -4.103 (est) |
| CAS DataBase Reference | 479-98-1(CAS DataBase Reference) |
Description and Uses
Aucubine 5-Acetatea is an impurity of Aucubine (A794730). Aucubine shows antioxidant and protective effects for the liver and kidney organs, shown in mice with induced diabetes.
