A7010358
5-Bromoindole , 10mMinDMSO , 10075-50-0
CAS NO.:10075-50-0
Empirical Formula: C8H6BrN
Molecular Weight: 196.04
MDL number: MFCD00005670
EINECS: 233-208-7
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 90-92 °C (lit.) |
| Boiling point: | 228.5°C (rough estimate) |
| Density | 1.5466 (rough estimate) |
| refractive index | 1.6550 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C |
| solubility | 126mg/l (calculated) |
| form | Powder or Chunks |
| pka | 16.04±0.30(Predicted) |
| color | White to light brown |
| BRN | 112877 |
| InChI | InChI=1S/C8H6BrN/c9-7-1-2-8-6(5-7)3-4-10-8/h1-5,10H |
| InChIKey | VXWVFZFZYXOBTA-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C(Br)C=C2)C=C1 |
| CAS DataBase Reference | 10075-50-0(CAS DataBase Reference) |
| EPA Substance Registry System | 1H-Indole, 5-bromo- (10075-50-0) |
Description and Uses
A potential inhibitor of GSK-3
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25-37/39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29339990 |






![5-Methyl-4,5,6,7-tetrahydrothiazolo[5,4-c]pyridin-2-amine](https://img.chemicalbook.com/CAS/GIF/17899-48-8.gif)
