A7019458
D-(+)-Maltosemonohydrate , 10mMinDMSO , 6363-53-7
Synonym(s):
D-(+)-Maltose monohydrate;Maltose monohydrate;Maltobiose;D -(+)-Maltose monohydrate;D -Maltose monohydrate
CAS NO.:6363-53-7
Empirical Formula: C12H24O12
Molecular Weight: 360.31
MDL number: MFCD00149343
EINECS: 613-294-6
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 119-121 °C (dec.)(lit.) |
| alpha | 137 º (c=4, H2O, NH3) |
| bulk density | 320kg/m3 |
| storage temp. | room temp |
| solubility | H2O: 50 mg/mL |
| form | powder |
| color | White |
| PH | 5.0-7.0 (25℃, 0.5M in H2O) |
| biological source | potato (tuber) |
| optical activity | [α]20/D +130±2°, 24 hr, c = 4% in H2O |
| Water Solubility | 1080 g/L (20 ºc) |
| λmax | λ: 260 nm Amax: 0.08 λ: 280 nm Amax: 0.07 |
| Merck | 14,5714 |
| BRN | 5784659 |
| InChI | 1S/C12H22O11.H2O/c13-1-4(16)7(18)11(5(17)2-14)23-12-10(21)9(20)8(19)6(3-15)22-12;/h1,4-12,14-21H,2-3H2;1H2/t4-,5+,6+,7+,8+,9-,10+,11+,12+;/m0./s1 |
| InChIKey | HBDJFVFTHLOSDW-DNDLZOGFSA-N |
| SMILES | O.OC[C@@H](O)[C@@H](O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)[C@H](O)[C@@H](O)C=O |
| CAS DataBase Reference | 6363-53-7(CAS DataBase Reference) |
| NIST Chemistry Reference | «beta»-Maltose monohydrate(6363-53-7) |
Description and Uses
D-(+)-Maltose monohydrate, is commonly found in foods and commonly utilized in brewing processes. It is also used in various culture media in the cell and tissue culture applications. D-(+)-Maltose Monohydrate is used as a substrate for α-glucosidase. It is also used as a substrate for the identification, differentiation and characterization of enzymes such as maltase(s); maltose α-D-glucosyltransferase(s); maltose-transporting ATPase(s); maltose O-acetyltransferase(s) and maltose epimerase(s) and phosphorylase(s). D-Maltose is used to study maltose-binding proteins and disaccharide transport systems.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 33-63-36/37/38 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 3 |
| RTECS | OO5250000 |
| F | 3 |
| TSCA | Yes |
| HS Code | 17029010 |
| Storage Class | 13 - Non Combustible Solids |




