A7031858
                    Ethyl(Triphenylphosphoranylidene)acetate , 10mMinDMSO , 1099-45-2
                            Synonym(s):
(Ethoxycarbonylmethylene)triphenylphosphorane;Ethyl (triphenylphosphoranylidene)acetate
                            
                        
                CAS NO.:1099-45-2
Empirical Formula: C22H21O2P
Molecular Weight: 348.37
MDL number: MFCD00009183
EINECS: 214-151-7
| Pack Size | Price | Stock | Quantity | 
| 1ml | RMB159.20 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 128-130 °C (lit.) | 
                                    
| Boiling point: | 490.4±28.0 °C(Predicted) | 
                                    
| Density | 1.086 g/cm3 | 
                                    
| storage temp. | 2-8°C | 
                                    
| solubility | Chloroform, THF | 
                                    
| form | Powder | 
                                    
| color | White to light yellow | 
                                    
| Water Solubility | Insoluble | 
                                    
| Sensitive | Air Sensitive | 
                                    
| BRN | 754639 | 
                                    
| InChI | InChI=1S/C22H21O2P/c1-2-24-22(23)18-25(19-12-6-3-7-13-19,20-14-8-4-9-15-20)21-16-10-5-11-17-21/h3-18H,2H2,1H3 | 
                                    
| InChIKey | IIHPVYJPDKJYOU-UHFFFAOYSA-N | 
                                    
| SMILES | C(OCC)(=O)C=P(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 | 
                                    
| CAS DataBase Reference | 1099-45-2(CAS DataBase Reference) | 
                                    
| EPA Substance Registry System | Acetic acid, (triphenylphosphoranylidene)-, ethyl ester (1099-45-2) | 
                                    
Description and Uses
A common Wittig reagent. A cholinesterase inhibitor.
Safety
| Symbol(GHS) | ![]() ![]() GHS09,GHS06  | 
                                    
| Signal word | Danger | 
| Hazard statements | H319-H411-H373-H300-H317 | 
| Precautionary statements | P264-P270-P301+P310-P321-P330-P405-P501-P264-P280-P305+P351+P338-P337+P313P-P261-P272-P280-P302+P352-P333+P313-P321-P363-P501-P260-P314-P501 | 
| Hazard Codes | T,Xi,Xn | 
| Risk Statements | 36/37/38-25-20/21/22 | 
| Safety Statements | 22-24/25-45-37/39-26-36 | 
| RIDADR | UN2811 | 
| WGK Germany | 3 | 
| Hazard Note | Irritant | 
| TSCA | Yes | 
| HS Code | 29310095 | 








