A7036258
Corilagin , 10mMinDMSO , 23094-69-1
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB516.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >200°C dec |
| Boiling point: | 1280.8±65.0 °C(Predicted) |
| Density | 2.11±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | H2O: soluble1mg/mL, clear, colorless |
| pka | 7.53±0.70(Predicted) |
| form | Solid |
| color | Off-White |
| Water Solubility | H2O: 1mg/mL, clear, colorless |
| Stability: | Hygroscopic |
| Major Application | food and beverages |
| InChIKey | TUSDEZXZIZRFGC-XIGLUPEJSA-N |
| SMILES | OC1C(=C(O)C=C2C(OC3C(O)C(OC(OC(C4C=C(O)C(O)=C(O)C=4)=O)C3O)COC(=O)C3=CC(O)=C(O)C(O)=C3C=12)=O)O |
Description and Uses
Corilagin is a polyphenol and hydrolyzable tannin that can be isolated from a variety of plants. It inhibits squalene epoxidase (IC50 = 4.0 μM), a key enzyme in cholesterol synthesis. Corilagin also has various anti-
Thrombolytic.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |







