PRODUCT Properties
| Melting point: | >145oC (dec.) |
| Boiling point: | 196°C |
| Density | 2.49±0.1 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | DMSO (Slightly, Heated), Methanol (Slightly), Water (Slightly) |
| pka | pK2: 4.2(-1);pK3: 7.20(-2) (25°C) |
| form | Solid |
| color | White to Off-White |
| optical activity | Consistent with structure |
| Merck | 13,155 |
| BRN | 67722 |
| InChIKey | XTWYTFMLZFPYCI-KQYNXXCUSA-N |
| SMILES | C(OP(=O)(O)OP(O)(O)=O)[C@H]1O[C@@H](N2C3C(=C(N=CN=3)N)N=C2)[C@H](O)[C@@H]1O |
| EPA Substance Registry System | Adenosine 5'-(trihydrogen diphosphate) (58-64-0) |
Description and Uses
Adenosine 5′-diphosphate (5′-ADP or ADP) was used as a test compound for studying the endothelium-dependent vascular response in salt sensitive (DS) and salt resistant Dahl rats (DR). The product was used to study the different P2-purinergic receptor subtypes on canine vascular smooth muscle and endothelium.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| RTECS | AU7467000 |
| F | 10-21 |
| TSCA | TSCA listed |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
